About (3-cyclopentyl-1,2-oxazol-5-yl)-piperidin-1-ylmethanone
(3-cyclopentyl-1,2-oxazol-5-yl)-piperidin-1-ylmethanone (PubChem CID 84585218) has the molecular formula C14H20N2O2
and a molecular weight of 248.33 g/mol. Its IUPAC name is (3-cyclopentyl-1,2-oxazol-5-yl)-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | (3-cyclopentyl-1,2-oxazol-5-yl)-piperidin-1-ylmethanone |
| PubChem CID | 84585218 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (3-cyclopentyl-1,2-oxazol-5-yl)-piperidin-1-ylmethanone |
| SMILES | O=C(c1cc(C2CCCC2)no1)N1CCCCC1 |
| InChI | InChI=1S/C14H20N2O2/c17-14(16-8-4-1-5-9-16)13-10-12(15-18-13)11-6-2-3-7-11/h10-11H,1-9H2 |
| InChIKey | QANUCKNIVGKWSD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-cyclopentyl-1,2-oxazol-5-yl)-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyclopentyl-1,2-oxazol-5-yl)-piperidin-1-ylmethanone?
The IUPAC name of (3-cyclopentyl-1,2-oxazol-5-yl)-piperidin-1-ylmethanone (CID 84585218) is (3-cyclopentyl-1,2-oxazol-5-yl)-piperidin-1-ylmethanone.
What is the SMILES notation for (3-cyclopentyl-1,2-oxazol-5-yl)-piperidin-1-ylmethanone?
The canonical SMILES for (3-cyclopentyl-1,2-oxazol-5-yl)-piperidin-1-ylmethanone is O=C(c1cc(C2CCCC2)no1)N1CCCCC1.
What is the InChIKey of (3-cyclopentyl-1,2-oxazol-5-yl)-piperidin-1-ylmethanone?
The InChIKey is QANUCKNIVGKWSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2/c17-14(16-8-4-1-5-9-16)13-10-12(15-18-13)11-6-2-3-7-11/h10-11H,1-9H2.
What are the key properties of (3-cyclopentyl-1,2-oxazol-5-yl)-piperidin-1-ylmethanone?
(3-cyclopentyl-1,2-oxazol-5-yl)-piperidin-1-ylmethanone has a molecular weight of 248.33 g/mol, XLogP of 2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyclopentyl-1,2-oxazol-5-yl)-piperidin-1-ylmethanone is sourced from PubChem (CID 84585218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).