C17H17ClFN3O — CID 84585423
[4-(2-chloroanilino)piperidin-1-yl]-(6-fluoro-3-pyridinyl)methanone (PubChem CID 84585423) has the molecular formula C17H17ClFN3O and a molecular weight of 333.79 g/mol. Its IUPAC name is [4-(2-chloroanilino)piperidin-1-yl]-(6-fluoro-3-pyridinyl)methanone.
| Compound Name | [4-(2-chloroanilino)piperidin-1-yl]-(6-fluoro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 84585423 |
| Molecular Formula | C17H17ClFN3O |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | [4-(2-chloroanilino)piperidin-1-yl]-(6-fluoro-3-pyridinyl)methanone |
| SMILES | O=C(c1ccc(F)nc1)N1CCC(Nc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H17ClFN3O/c18-14-3-1-2-4-15(14)21-13-7-9-22(10-8-13)17(23)12-5-6-16(19)20-11-12/h1-6,11,13,21H,7-10H2 |
| InChIKey | JGWYXEOEIHOPGD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|