C16H27N5O2 — CID 84586058
1-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-[4-(oxolan-2-yl)butan-2-yl]urea (PubChem CID 84586058) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 1-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-[4-(oxolan-2-yl)butan-2-yl]urea.
| Compound Name | 1-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-[4-(oxolan-2-yl)butan-2-yl]urea |
|---|---|
| PubChem CID | 84586058 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 1-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-3-[4-(oxolan-2-yl)butan-2-yl]urea |
| SMILES | Cc1nc2n(n1)CCCC2NC(=O)NC(C)CCC1CCCO1 |
| InChI | InChI=1S/C16H27N5O2/c1-11(7-8-13-5-4-10-23-13)17-16(22)19-14-6-3-9-21-15(14)18-12(2)20-21/h11,13-14H,3-10H2,1-2H3,(H2,17,19,22) |
| InChIKey | YMWBVGCCLSXMEY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |