C20H30N2O2 — CID 84586067
1-[4-(oxan-2-ylmethyl)-1,4-diazepan-1-yl]-3-phenylpropan-1-one (PubChem CID 84586067) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-[4-(oxan-2-ylmethyl)-1,4-diazepan-1-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[4-(oxan-2-ylmethyl)-1,4-diazepan-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 84586067 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 1-[4-(oxan-2-ylmethyl)-1,4-diazepan-1-yl]-3-phenylpropan-1-one |
| SMILES | O=C(CCc1ccccc1)N1CCCN(CC2CCCCO2)CC1 |
| InChI | InChI=1S/C20H30N2O2/c23-20(11-10-18-7-2-1-3-8-18)22-13-6-12-21(14-15-22)17-19-9-4-5-16-24-19/h1-3,7-8,19H,4-6,9-17H2 |
| InChIKey | GITWAELRMNQJBT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |