C13H13N5O3S — CID 84586094
5-nitro-2-[(5-propyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-benzoxazole (PubChem CID 84586094) has the molecular formula C13H13N5O3S and a molecular weight of 319.35 g/mol. Its IUPAC name is 5-nitro-2-[(5-propyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-benzoxazole.
| Compound Name | 5-nitro-2-[(5-propyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 84586094 |
| Molecular Formula | C13H13N5O3S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 5-nitro-2-[(5-propyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-benzoxazole |
| SMILES | CCCc1nc(SCc2nc3cc([N+](=O)[O-])ccc3o2)n[nH]1 |
| InChI | InChI=1S/C13H13N5O3S/c1-2-3-11-15-13(17-16-11)22-7-12-14-9-6-8(18(19)20)4-5-10(9)21-12/h4-6H,2-3,7H2,1H3,(H,15,16,17) |
| InChIKey | GGLFENQDYYKXKZ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|