C11H9N3O2S — CID 84586211
4-methyl-5-[(E)-2-(5-nitro-2-pyridinyl)ethenyl]-1,3-thiazole (PubChem CID 84586211) has the molecular formula C11H9N3O2S and a molecular weight of 247.28 g/mol. Its IUPAC name is 4-methyl-5-[(E)-2-(5-nitro-2-pyridinyl)ethenyl]-1,3-thiazole.
| Compound Name | 4-methyl-5-[(E)-2-(5-nitro-2-pyridinyl)ethenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 84586211 |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 4-methyl-5-[(E)-2-(5-nitro-2-pyridinyl)ethenyl]-1,3-thiazole |
| SMILES | Cc1ncsc1/C=C/c1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C11H9N3O2S/c1-8-11(17-7-13-8)5-3-9-2-4-10(6-12-9)14(15)16/h2-7H,1H3/b5-3+ |
| InChIKey | OBKCXPKIFRVPQW-HWKANZROSA-N |
| XLogP | 2.93 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|