About (2-methoxycyclopentyl) 6-methyl-2-oxo-5-phenyl-1H-pyridine-3-carboxylate
(2-methoxycyclopentyl) 6-methyl-2-oxo-5-phenyl-1H-pyridine-3-carboxylate (PubChem CID 84586297) has the molecular formula C19H21NO4
and a molecular weight of 327.38 g/mol. Its IUPAC name is (2-methoxycyclopentyl) 6-methyl-2-oxo-5-phenyl-1H-pyridine-3-carboxylate.
Molecular Properties
| Compound Name | (2-methoxycyclopentyl) 6-methyl-2-oxo-5-phenyl-1H-pyridine-3-carboxylate |
| PubChem CID | 84586297 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (2-methoxycyclopentyl) 6-methyl-2-oxo-5-phenyl-1H-pyridine-3-carboxylate |
| SMILES | COC1CCCC1OC(=O)c1cc(-c2ccccc2)c(C)[nH]c1=O |
| InChI | InChI=1S/C19H21NO4/c1-12-14(13-7-4-3-5-8-13)11-15(18(21)20-12)19(22)24-17-10-6-9-16(17)23-2/h3-5,7-8,11,16-17H,6,9-10H2,1-2H3,(H,20,21) |
| InChIKey | GXIRKHXIWCLGBZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-methoxycyclopentyl) 6-methyl-2-oxo-5-phenyl-1H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methoxycyclopentyl) 6-methyl-2-oxo-5-phenyl-1H-pyridine-3-carboxylate?
The IUPAC name of (2-methoxycyclopentyl) 6-methyl-2-oxo-5-phenyl-1H-pyridine-3-carboxylate (CID 84586297) is (2-methoxycyclopentyl) 6-methyl-2-oxo-5-phenyl-1H-pyridine-3-carboxylate.
What is the SMILES notation for (2-methoxycyclopentyl) 6-methyl-2-oxo-5-phenyl-1H-pyridine-3-carboxylate?
The canonical SMILES for (2-methoxycyclopentyl) 6-methyl-2-oxo-5-phenyl-1H-pyridine-3-carboxylate is COC1CCCC1OC(=O)c1cc(-c2ccccc2)c(C)[nH]c1=O.
What is the InChIKey of (2-methoxycyclopentyl) 6-methyl-2-oxo-5-phenyl-1H-pyridine-3-carboxylate?
The InChIKey is GXIRKHXIWCLGBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO4/c1-12-14(13-7-4-3-5-8-13)11-15(18(21)20-12)19(22)24-17-10-6-9-16(17)23-2/h3-5,7-8,11,16-17H,6,9-10H2,1-2H3,(H,20,21).
What are the key properties of (2-methoxycyclopentyl) 6-methyl-2-oxo-5-phenyl-1H-pyridine-3-carboxylate?
(2-methoxycyclopentyl) 6-methyl-2-oxo-5-phenyl-1H-pyridine-3-carboxylate has a molecular weight of 327.38 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxycyclopentyl) 6-methyl-2-oxo-5-phenyl-1H-pyridine-3-carboxylate is sourced from PubChem (CID 84586297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).