About N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(4-propylpiperazin-1-yl)phenyl]methanamine
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(4-propylpiperazin-1-yl)phenyl]methanamine (PubChem CID 84586533) has the molecular formula C20H30N4O
and a molecular weight of 342.49 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(4-propylpiperazin-1-yl)phenyl]methanamine.
Molecular Properties
| Compound Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(4-propylpiperazin-1-yl)phenyl]methanamine |
| PubChem CID | 84586533 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(4-propylpiperazin-1-yl)phenyl]methanamine |
| SMILES | CCCN1CCN(c2ccccc2CNCc2c(C)noc2C)CC1 |
| InChI | InChI=1S/C20H30N4O/c1-4-9-23-10-12-24(13-11-23)20-8-6-5-7-18(20)14-21-15-19-16(2)22-25-17(19)3/h5-8,21H,4,9-15H2,1-3H3 |
| InChIKey | PAJIGPPPUZJDGX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 44.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(4-propylpiperazin-1-yl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(4-propylpiperazin-1-yl)phenyl]methanamine?
The IUPAC name of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(4-propylpiperazin-1-yl)phenyl]methanamine (CID 84586533) is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(4-propylpiperazin-1-yl)phenyl]methanamine.
What is the SMILES notation for N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(4-propylpiperazin-1-yl)phenyl]methanamine?
The canonical SMILES for N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(4-propylpiperazin-1-yl)phenyl]methanamine is CCCN1CCN(c2ccccc2CNCc2c(C)noc2C)CC1.
What is the InChIKey of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(4-propylpiperazin-1-yl)phenyl]methanamine?
The InChIKey is PAJIGPPPUZJDGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N4O/c1-4-9-23-10-12-24(13-11-23)20-8-6-5-7-18(20)14-21-15-19-16(2)22-25-17(19)3/h5-8,21H,4,9-15H2,1-3H3.
What are the key properties of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(4-propylpiperazin-1-yl)phenyl]methanamine?
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(4-propylpiperazin-1-yl)phenyl]methanamine has a molecular weight of 342.49 g/mol, XLogP of 3.11, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-1-[2-(4-propylpiperazin-1-yl)phenyl]methanamine is sourced from PubChem (CID 84586533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).