C13H17F2NO3S — CID 84586609
2-(2,6-difluorophenyl)-N-(2,2-dimethylpropylsulfonyl)acetamide (PubChem CID 84586609) has the molecular formula C13H17F2NO3S and a molecular weight of 305.35 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-N-(2,2-dimethylpropylsulfonyl)acetamide.
| Compound Name | 2-(2,6-difluorophenyl)-N-(2,2-dimethylpropylsulfonyl)acetamide |
|---|---|
| PubChem CID | 84586609 |
| Molecular Formula | C13H17F2NO3S |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-(2,6-difluorophenyl)-N-(2,2-dimethylpropylsulfonyl)acetamide |
| SMILES | CC(C)(C)CS(=O)(=O)NC(=O)Cc1c(F)cccc1F |
| InChI | InChI=1S/C13H17F2NO3S/c1-13(2,3)8-20(18,19)16-12(17)7-9-10(14)5-4-6-11(9)15/h4-6H,7-8H2,1-3H3,(H,16,17) |
| InChIKey | NKPZQCLEGOQXAT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |