About N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-fluoro-2-iodoaniline
N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-fluoro-2-iodoaniline (PubChem CID 84587001) has the molecular formula C11H11FIN3O
and a molecular weight of 347.13 g/mol. Its IUPAC name is N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-fluoro-2-iodoaniline.
Molecular Properties
| Compound Name | N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-fluoro-2-iodoaniline |
| PubChem CID | 84587001 |
| Molecular Formula | C11H11FIN3O |
| Molecular Weight | 347.13 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-fluoro-2-iodoaniline |
| SMILES | CCc1nc(CNc2ccc(F)cc2I)no1 |
| InChI | InChI=1S/C11H11FIN3O/c1-2-11-15-10(16-17-11)6-14-9-4-3-7(12)5-8(9)13/h3-5,14H,2,6H2,1H3 |
| InChIKey | TXFOXGAOAONEFY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.13 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-fluoro-2-iodoaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-fluoro-2-iodoaniline?
The IUPAC name of N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-fluoro-2-iodoaniline (CID 84587001) is N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-fluoro-2-iodoaniline.
What is the SMILES notation for N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-fluoro-2-iodoaniline?
The canonical SMILES for N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-fluoro-2-iodoaniline is CCc1nc(CNc2ccc(F)cc2I)no1.
What is the InChIKey of N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-fluoro-2-iodoaniline?
The InChIKey is TXFOXGAOAONEFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FIN3O/c1-2-11-15-10(16-17-11)6-14-9-4-3-7(12)5-8(9)13/h3-5,14H,2,6H2,1H3.
What are the key properties of N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-fluoro-2-iodoaniline?
N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-fluoro-2-iodoaniline has a molecular weight of 347.13 g/mol, XLogP of 2.99, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-4-fluoro-2-iodoaniline is sourced from PubChem (CID 84587001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).