C16H13F2N3O4 — CID 84587040
2-(3,4-difluorophenyl)-N-[2-(2-nitroanilino)-2-oxoethyl]acetamide (PubChem CID 84587040) has the molecular formula C16H13F2N3O4 and a molecular weight of 349.29 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-N-[2-(2-nitroanilino)-2-oxoethyl]acetamide.
| Compound Name | 2-(3,4-difluorophenyl)-N-[2-(2-nitroanilino)-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 84587040 |
| Molecular Formula | C16H13F2N3O4 |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-(3,4-difluorophenyl)-N-[2-(2-nitroanilino)-2-oxoethyl]acetamide |
| SMILES | O=C(Cc1ccc(F)c(F)c1)NCC(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13F2N3O4/c17-11-6-5-10(7-12(11)18)8-15(22)19-9-16(23)20-13-3-1-2-4-14(13)21(24)25/h1-7H,8-9H2,(H,19,22)(H,20,23) |
| InChIKey | HWJQRYWPUJVFMM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|