C12H9BrN6O2 — CID 84587545
5-bromo-3-nitro-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyridin-2-amine (PubChem CID 84587545) has the molecular formula C12H9BrN6O2 and a molecular weight of 349.15 g/mol. Its IUPAC name is 5-bromo-3-nitro-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyridin-2-amine.
| Compound Name | 5-bromo-3-nitro-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 84587545 |
| Molecular Formula | C12H9BrN6O2 |
| Molecular Weight | 349.15 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 5-bromo-3-nitro-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)pyridin-2-amine |
| SMILES | O=[N+]([O-])c1cc(Br)cnc1NCc1nnc2ccccn12 |
| InChI | InChI=1S/C12H9BrN6O2/c13-8-5-9(19(20)21)12(14-6-8)15-7-11-17-16-10-3-1-2-4-18(10)11/h1-6H,7H2,(H,14,15) |
| InChIKey | QWTCAXSCNICEMG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.15 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|