About 5-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethyl]-4-methyl-1,3-thiazole
5-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethyl]-4-methyl-1,3-thiazole (PubChem CID 84589047) has the molecular formula C15H17N5O2S
and a molecular weight of 331.40 g/mol. Its IUPAC name is 5-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethyl]-4-methyl-1,3-thiazole.
Molecular Properties
| Compound Name | 5-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethyl]-4-methyl-1,3-thiazole |
| PubChem CID | 84589047 |
| Molecular Formula | C15H17N5O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 5-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethyl]-4-methyl-1,3-thiazole |
| SMILES | COc1ccc(-c2nnn(CCc3scnc3C)n2)cc1OC |
| InChI | InChI=1S/C15H17N5O2S/c1-10-14(23-9-16-10)6-7-20-18-15(17-19-20)11-4-5-12(21-2)13(8-11)22-3/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | UNBRNWQOXCYMMH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethyl]-4-methyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethyl]-4-methyl-1,3-thiazole?
The IUPAC name of 5-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethyl]-4-methyl-1,3-thiazole (CID 84589047) is 5-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethyl]-4-methyl-1,3-thiazole.
What is the SMILES notation for 5-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethyl]-4-methyl-1,3-thiazole?
The canonical SMILES for 5-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethyl]-4-methyl-1,3-thiazole is COc1ccc(-c2nnn(CCc3scnc3C)n2)cc1OC.
What is the InChIKey of 5-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethyl]-4-methyl-1,3-thiazole?
The InChIKey is UNBRNWQOXCYMMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N5O2S/c1-10-14(23-9-16-10)6-7-20-18-15(17-19-20)11-4-5-12(21-2)13(8-11)22-3/h4-5,8-9H,6-7H2,1-3H3.
What are the key properties of 5-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethyl]-4-methyl-1,3-thiazole?
5-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethyl]-4-methyl-1,3-thiazole has a molecular weight of 331.40 g/mol, XLogP of 2.36, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]ethyl]-4-methyl-1,3-thiazole is sourced from PubChem (CID 84589047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).