C19H38N4 — CID 84589491
N-[2-[4-(dimethylamino)piperidin-1-yl]-2-methylpropyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine (PubChem CID 84589491) has the molecular formula C19H38N4 and a molecular weight of 322.54 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)piperidin-1-yl]-2-methylpropyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine.
| Compound Name | N-[2-[4-(dimethylamino)piperidin-1-yl]-2-methylpropyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine |
|---|---|
| PubChem CID | 84589491 |
| Molecular Formula | C19H38N4 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.31 |
| IUPAC Name | N-[2-[4-(dimethylamino)piperidin-1-yl]-2-methylpropyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine |
| SMILES | CN(C)C1CCN(C(C)(C)CNC2CCN3CCCC3C2)CC1 |
| InChI | InChI=1S/C19H38N4/c1-19(2,23-12-8-17(9-13-23)21(3)4)15-20-16-7-11-22-10-5-6-18(22)14-16/h16-18,20H,5-15H2,1-4H3 |
| InChIKey | VLFKBJYQSRUVMU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |