C19H26N2O2 — CID 84589683
2-methoxy-5-[[4-(oxan-4-yl)piperidin-1-yl]methyl]benzonitrile (PubChem CID 84589683) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-methoxy-5-[[4-(oxan-4-yl)piperidin-1-yl]methyl]benzonitrile.
| Compound Name | 2-methoxy-5-[[4-(oxan-4-yl)piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 84589683 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 2-methoxy-5-[[4-(oxan-4-yl)piperidin-1-yl]methyl]benzonitrile |
| SMILES | COc1ccc(CN2CCC(C3CCOCC3)CC2)cc1C#N |
| InChI | InChI=1S/C19H26N2O2/c1-22-19-3-2-15(12-18(19)13-20)14-21-8-4-16(5-9-21)17-6-10-23-11-7-17/h2-3,12,16-17H,4-11,14H2,1H3 |
| InChIKey | ILMWIXUTBYTNFP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |