C18H25N3O — CID 84589689
7-methoxy-N-[3-(4-methylpyrazol-1-yl)propyl]-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 84589689) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 7-methoxy-N-[3-(4-methylpyrazol-1-yl)propyl]-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 7-methoxy-N-[3-(4-methylpyrazol-1-yl)propyl]-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 84589689 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 7-methoxy-N-[3-(4-methylpyrazol-1-yl)propyl]-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | COc1ccc2c(c1)CC(NCCCn1cc(C)cn1)CC2 |
| InChI | InChI=1S/C18H25N3O/c1-14-12-20-21(13-14)9-3-8-19-17-6-4-15-5-7-18(22-2)11-16(15)10-17/h5,7,11-13,17,19H,3-4,6,8-10H2,1-2H3 |
| InChIKey | YAZRXKRHWVBCTE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|