About 1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one
1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one (PubChem CID 84589734) has the molecular formula C14H17ClN2O
and a molecular weight of 264.76 g/mol. Its IUPAC name is 1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one |
| PubChem CID | 84589734 |
| Molecular Formula | C14H17ClN2O |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C2CCc3c(Cl)cccc32)CCN1 |
| InChI | InChI=1S/C14H17ClN2O/c15-12-3-1-2-11-10(12)4-5-13(11)17-8-6-14(18)16-7-9-17/h1-3,13H,4-9H2,(H,16,18) |
| InChIKey | UIILOYPQMHINJQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one?
The IUPAC name of 1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one (CID 84589734) is 1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one.
What is the SMILES notation for 1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one?
The canonical SMILES for 1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one is O=C1CCN(C2CCc3c(Cl)cccc32)CCN1.
What is the InChIKey of 1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one?
The InChIKey is UIILOYPQMHINJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClN2O/c15-12-3-1-2-11-10(12)4-5-13(11)17-8-6-14(18)16-7-9-17/h1-3,13H,4-9H2,(H,16,18).
What are the key properties of 1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one?
1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one has a molecular weight of 264.76 g/mol, XLogP of 2.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-2,3-dihydro-1H-inden-1-yl)-1,4-diazepan-5-one is sourced from PubChem (CID 84589734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).