About 2-[2,2-dimethylpropyl(dimethylsulfamoyl)amino]ethanol
2-[2,2-dimethylpropyl(dimethylsulfamoyl)amino]ethanol (PubChem CID 84589913) has the molecular formula C9H22N2O3S
and a molecular weight of 238.35 g/mol. Its IUPAC name is 2-[2,2-dimethylpropyl(dimethylsulfamoyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[2,2-dimethylpropyl(dimethylsulfamoyl)amino]ethanol |
| PubChem CID | 84589913 |
| Molecular Formula | C9H22N2O3S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 2-[2,2-dimethylpropyl(dimethylsulfamoyl)amino]ethanol |
| SMILES | CN(C)S(=O)(=O)N(CCO)CC(C)(C)C |
| InChI | InChI=1S/C9H22N2O3S/c1-9(2,3)8-11(6-7-12)15(13,14)10(4)5/h12H,6-8H2,1-5H3 |
| InChIKey | FOYCEBACGMMZNY-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2,2-dimethylpropyl(dimethylsulfamoyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-dimethylpropyl(dimethylsulfamoyl)amino]ethanol?
The IUPAC name of 2-[2,2-dimethylpropyl(dimethylsulfamoyl)amino]ethanol (CID 84589913) is 2-[2,2-dimethylpropyl(dimethylsulfamoyl)amino]ethanol.
What is the SMILES notation for 2-[2,2-dimethylpropyl(dimethylsulfamoyl)amino]ethanol?
The canonical SMILES for 2-[2,2-dimethylpropyl(dimethylsulfamoyl)amino]ethanol is CN(C)S(=O)(=O)N(CCO)CC(C)(C)C.
What is the InChIKey of 2-[2,2-dimethylpropyl(dimethylsulfamoyl)amino]ethanol?
The InChIKey is FOYCEBACGMMZNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O3S/c1-9(2,3)8-11(6-7-12)15(13,14)10(4)5/h12H,6-8H2,1-5H3.
What are the key properties of 2-[2,2-dimethylpropyl(dimethylsulfamoyl)amino]ethanol?
2-[2,2-dimethylpropyl(dimethylsulfamoyl)amino]ethanol has a molecular weight of 238.35 g/mol, XLogP of 0.13, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-dimethylpropyl(dimethylsulfamoyl)amino]ethanol is sourced from PubChem (CID 84589913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).