C18H18N4O3 — CID 84590046
N-methyl-4-(5-methyl-3,4-dihydropyrazol-2-yl)-N-(3-nitrophenyl)benzamide (PubChem CID 84590046) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is N-methyl-4-(5-methyl-3,4-dihydropyrazol-2-yl)-N-(3-nitrophenyl)benzamide.
| Compound Name | N-methyl-4-(5-methyl-3,4-dihydropyrazol-2-yl)-N-(3-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 84590046 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N-methyl-4-(5-methyl-3,4-dihydropyrazol-2-yl)-N-(3-nitrophenyl)benzamide |
| SMILES | CC1=NN(c2ccc(C(=O)N(C)c3cccc([N+](=O)[O-])c3)cc2)CC1 |
| InChI | InChI=1S/C18H18N4O3/c1-13-10-11-21(19-13)15-8-6-14(7-9-15)18(23)20(2)16-4-3-5-17(12-16)22(24)25/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | SWIYYOWIXRYURM-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|