C15H20F4N2O — CID 84590178
4-[[[4-fluoro-3-(trifluoromethyl)phenyl]methylamino]methyl]-1-methylpiperidin-4-ol (PubChem CID 84590178) has the molecular formula C15H20F4N2O and a molecular weight of 320.33 g/mol. Its IUPAC name is 4-[[[4-fluoro-3-(trifluoromethyl)phenyl]methylamino]methyl]-1-methylpiperidin-4-ol.
| Compound Name | 4-[[[4-fluoro-3-(trifluoromethyl)phenyl]methylamino]methyl]-1-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 84590178 |
| Molecular Formula | C15H20F4N2O |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 4-[[[4-fluoro-3-(trifluoromethyl)phenyl]methylamino]methyl]-1-methylpiperidin-4-ol |
| SMILES | CN1CCC(O)(CNCc2ccc(F)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H20F4N2O/c1-21-6-4-14(22,5-7-21)10-20-9-11-2-3-13(16)12(8-11)15(17,18)19/h2-3,8,20,22H,4-7,9-10H2,1H3 |
| InChIKey | ZYSRDEFQIDRCQA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |