About N-(4-cyanothian-4-yl)-2,5-dimethylpyrazole-3-carboxamide
N-(4-cyanothian-4-yl)-2,5-dimethylpyrazole-3-carboxamide (PubChem CID 84590390) has the molecular formula C12H16N4OS
and a molecular weight of 264.35 g/mol. Its IUPAC name is N-(4-cyanothian-4-yl)-2,5-dimethylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(4-cyanothian-4-yl)-2,5-dimethylpyrazole-3-carboxamide |
| PubChem CID | 84590390 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | N-(4-cyanothian-4-yl)-2,5-dimethylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC2(C#N)CCSCC2)n(C)n1 |
| InChI | InChI=1S/C12H16N4OS/c1-9-7-10(16(2)15-9)11(17)14-12(8-13)3-5-18-6-4-12/h7H,3-6H2,1-2H3,(H,14,17) |
| InChIKey | PBUJQDDNGKXDID-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(4-cyanothian-4-yl)-2,5-dimethylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyanothian-4-yl)-2,5-dimethylpyrazole-3-carboxamide?
The IUPAC name of N-(4-cyanothian-4-yl)-2,5-dimethylpyrazole-3-carboxamide (CID 84590390) is N-(4-cyanothian-4-yl)-2,5-dimethylpyrazole-3-carboxamide.
What is the SMILES notation for N-(4-cyanothian-4-yl)-2,5-dimethylpyrazole-3-carboxamide?
The canonical SMILES for N-(4-cyanothian-4-yl)-2,5-dimethylpyrazole-3-carboxamide is Cc1cc(C(=O)NC2(C#N)CCSCC2)n(C)n1.
What is the InChIKey of N-(4-cyanothian-4-yl)-2,5-dimethylpyrazole-3-carboxamide?
The InChIKey is PBUJQDDNGKXDID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4OS/c1-9-7-10(16(2)15-9)11(17)14-12(8-13)3-5-18-6-4-12/h7H,3-6H2,1-2H3,(H,14,17).
What are the key properties of N-(4-cyanothian-4-yl)-2,5-dimethylpyrazole-3-carboxamide?
N-(4-cyanothian-4-yl)-2,5-dimethylpyrazole-3-carboxamide has a molecular weight of 264.35 g/mol, XLogP of 1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyanothian-4-yl)-2,5-dimethylpyrazole-3-carboxamide is sourced from PubChem (CID 84590390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).