C11H12F3NO4 — CID 84590418
1-methyl-2-nitro-3-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene (PubChem CID 84590418) has the molecular formula C11H12F3NO4 and a molecular weight of 279.21 g/mol. Its IUPAC name is 1-methyl-2-nitro-3-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene.
| Compound Name | 1-methyl-2-nitro-3-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 84590418 |
| Molecular Formula | C11H12F3NO4 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 1-methyl-2-nitro-3-[2-(2,2,2-trifluoroethoxy)ethoxy]benzene |
| SMILES | Cc1cccc(OCCOCC(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12F3NO4/c1-8-3-2-4-9(10(8)15(16)17)19-6-5-18-7-11(12,13)14/h2-4H,5-7H2,1H3 |
| InChIKey | VYQAZKWWGUKYEI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|