About 4,5-dimethyl-2-(1,4-thiazepan-4-ylmethyl)-1,3-oxazole
4,5-dimethyl-2-(1,4-thiazepan-4-ylmethyl)-1,3-oxazole (PubChem CID 84590606) has the molecular formula C11H18N2OS
and a molecular weight of 226.34 g/mol. Its IUPAC name is 4,5-dimethyl-2-(1,4-thiazepan-4-ylmethyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 4,5-dimethyl-2-(1,4-thiazepan-4-ylmethyl)-1,3-oxazole |
| PubChem CID | 84590606 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 4,5-dimethyl-2-(1,4-thiazepan-4-ylmethyl)-1,3-oxazole |
| SMILES | Cc1nc(CN2CCCSCC2)oc1C |
| InChI | InChI=1S/C11H18N2OS/c1-9-10(2)14-11(12-9)8-13-4-3-6-15-7-5-13/h3-8H2,1-2H3 |
| InChIKey | GSHQFBDZDBRRPC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-dimethyl-2-(1,4-thiazepan-4-ylmethyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2-(1,4-thiazepan-4-ylmethyl)-1,3-oxazole?
The IUPAC name of 4,5-dimethyl-2-(1,4-thiazepan-4-ylmethyl)-1,3-oxazole (CID 84590606) is 4,5-dimethyl-2-(1,4-thiazepan-4-ylmethyl)-1,3-oxazole.
What is the SMILES notation for 4,5-dimethyl-2-(1,4-thiazepan-4-ylmethyl)-1,3-oxazole?
The canonical SMILES for 4,5-dimethyl-2-(1,4-thiazepan-4-ylmethyl)-1,3-oxazole is Cc1nc(CN2CCCSCC2)oc1C.
What is the InChIKey of 4,5-dimethyl-2-(1,4-thiazepan-4-ylmethyl)-1,3-oxazole?
The InChIKey is GSHQFBDZDBRRPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2OS/c1-9-10(2)14-11(12-9)8-13-4-3-6-15-7-5-13/h3-8H2,1-2H3.
What are the key properties of 4,5-dimethyl-2-(1,4-thiazepan-4-ylmethyl)-1,3-oxazole?
4,5-dimethyl-2-(1,4-thiazepan-4-ylmethyl)-1,3-oxazole has a molecular weight of 226.34 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2-(1,4-thiazepan-4-ylmethyl)-1,3-oxazole is sourced from PubChem (CID 84590606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).