C14H21N3O2S — CID 84591263
1-[2-[2-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-ylamino]ethyl]pyrrolidine-2,5-dione (PubChem CID 84591263) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 1-[2-[2-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-ylamino]ethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[2-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-ylamino]ethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 84591263 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-[2-[2-(4,5-dimethyl-1,3-thiazol-2-yl)propan-2-ylamino]ethyl]pyrrolidine-2,5-dione |
| SMILES | Cc1nc(C(C)(C)NCCN2C(=O)CCC2=O)sc1C |
| InChI | InChI=1S/C14H21N3O2S/c1-9-10(2)20-13(16-9)14(3,4)15-7-8-17-11(18)5-6-12(17)19/h15H,5-8H2,1-4H3 |
| InChIKey | UNWMBYFAZKHWIR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|