About N-(1-amino-2,4-dimethylpentan-2-yl)methanesulfonamide
N-(1-amino-2,4-dimethylpentan-2-yl)methanesulfonamide (PubChem CID 84591478) has the molecular formula C8H20N2O2S
and a molecular weight of 208.33 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)methanesulfonamide.
Molecular Properties
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)methanesulfonamide |
| PubChem CID | 84591478 |
| Molecular Formula | C8H20N2O2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)methanesulfonamide |
| SMILES | CC(C)CC(C)(CN)NS(C)(=O)=O |
| InChI | InChI=1S/C8H20N2O2S/c1-7(2)5-8(3,6-9)10-13(4,11)12/h7,10H,5-6,9H2,1-4H3 |
| InChIKey | JOBBARVBCMDCDV-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-amino-2,4-dimethylpentan-2-yl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-amino-2,4-dimethylpentan-2-yl)methanesulfonamide?
The IUPAC name of N-(1-amino-2,4-dimethylpentan-2-yl)methanesulfonamide (CID 84591478) is N-(1-amino-2,4-dimethylpentan-2-yl)methanesulfonamide.
What is the SMILES notation for N-(1-amino-2,4-dimethylpentan-2-yl)methanesulfonamide?
The canonical SMILES for N-(1-amino-2,4-dimethylpentan-2-yl)methanesulfonamide is CC(C)CC(C)(CN)NS(C)(=O)=O.
What is the InChIKey of N-(1-amino-2,4-dimethylpentan-2-yl)methanesulfonamide?
The InChIKey is JOBBARVBCMDCDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2O2S/c1-7(2)5-8(3,6-9)10-13(4,11)12/h7,10H,5-6,9H2,1-4H3.
What are the key properties of N-(1-amino-2,4-dimethylpentan-2-yl)methanesulfonamide?
N-(1-amino-2,4-dimethylpentan-2-yl)methanesulfonamide has a molecular weight of 208.33 g/mol, XLogP of 0.30, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-amino-2,4-dimethylpentan-2-yl)methanesulfonamide is sourced from PubChem (CID 84591478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).