C14H19N3O — CID 84592616
3,5-dimethyl-1-[(4-propoxyphenyl)methyl]-1,2,4-triazole (PubChem CID 84592616) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 3,5-dimethyl-1-[(4-propoxyphenyl)methyl]-1,2,4-triazole.
| Compound Name | 3,5-dimethyl-1-[(4-propoxyphenyl)methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 84592616 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 3,5-dimethyl-1-[(4-propoxyphenyl)methyl]-1,2,4-triazole |
| SMILES | CCCOc1ccc(Cn2nc(C)nc2C)cc1 |
| InChI | InChI=1S/C14H19N3O/c1-4-9-18-14-7-5-13(6-8-14)10-17-12(3)15-11(2)16-17/h5-8H,4,9-10H2,1-3H3 |
| InChIKey | PNKDAQSXTHXFHL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |