methyl 2-[(1-cyclopentyl-2,2,2-trifluoroethyl)amino]acetate

C10H16F3NO2 — CID 84593040

IUPACmethyl 2-[(1-cyclopentyl-2,2,2-trifluoroethyl)amino]acetate
SMILESCOC(=O)CNC(C1CCCC1)C(F)(F)F
InChIInChI=1S/C10H16F3NO2/c1-16-8(15)6-14-9(10(11,12)13)7-4-2-3-5-7/h7,9,14H,2-6H2,1H3
InChIKeyQFMQDRIOHXKRFD-UHFFFAOYSA-N
MW239.24 g/mol
LogP1.87
Rot. Bonds4

About methyl 2-[(1-cyclopentyl-2,2,2-trifluoroethyl)amino]acetate

methyl 2-[(1-cyclopentyl-2,2,2-trifluoroethyl)amino]acetate (PubChem CID 84593040) has the molecular formula C10H16F3NO2 and a molecular weight of 239.24 g/mol. Its IUPAC name is methyl 2-[(1-cyclopentyl-2,2,2-trifluoroethyl)amino]acetate.

Molecular Properties

Compound Namemethyl 2-[(1-cyclopentyl-2,2,2-trifluoroethyl)amino]acetate
PubChem CID84593040
Molecular FormulaC10H16F3NO2
Molecular Weight239.24 g/mol
Exact Mass239.11
IUPAC Namemethyl 2-[(1-cyclopentyl-2,2,2-trifluoroethyl)amino]acetate
SMILESCOC(=O)CNC(C1CCCC1)C(F)(F)F
InChIInChI=1S/C10H16F3NO2/c1-16-8(15)6-14-9(10(11,12)13)7-4-2-3-5-7/h7,9,14H,2-6H2,1H3
InChIKeyQFMQDRIOHXKRFD-UHFFFAOYSA-N
XLogP1.87
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.24
LogP ≤ 51.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-[(1-cyclopentyl-2,2,2-trifluoroethyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(1-cyclopentyl-2,2,2-trifluoroethyl)amino]acetate?
The IUPAC name of methyl 2-[(1-cyclopentyl-2,2,2-trifluoroethyl)amino]acetate (CID 84593040) is methyl 2-[(1-cyclopentyl-2,2,2-trifluoroethyl)amino]acetate.
What is the SMILES notation for methyl 2-[(1-cyclopentyl-2,2,2-trifluoroethyl)amino]acetate?
The canonical SMILES for methyl 2-[(1-cyclopentyl-2,2,2-trifluoroethyl)amino]acetate is COC(=O)CNC(C1CCCC1)C(F)(F)F.
What is the InChIKey of methyl 2-[(1-cyclopentyl-2,2,2-trifluoroethyl)amino]acetate?
The InChIKey is QFMQDRIOHXKRFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3NO2/c1-16-8(15)6-14-9(10(11,12)13)7-4-2-3-5-7/h7,9,14H,2-6H2,1H3.
What are the key properties of methyl 2-[(1-cyclopentyl-2,2,2-trifluoroethyl)amino]acetate?
methyl 2-[(1-cyclopentyl-2,2,2-trifluoroethyl)amino]acetate has a molecular weight of 239.24 g/mol, XLogP of 1.87, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1-cyclopentyl-2,2,2-trifluoroethyl)amino]acetate is sourced from PubChem (CID 84593040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).