C18H21FN4O2 — CID 84593161
4-[3-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]propyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 84593161) has the molecular formula C18H21FN4O2 and a molecular weight of 344.39 g/mol. Its IUPAC name is 4-[3-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]propyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 4-[3-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]propyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 84593161 |
| Molecular Formula | C18H21FN4O2 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 4-[3-[(6-ethyl-5-fluoropyrimidin-4-yl)amino]propyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CCc1ncnc(NCCCN2C(=O)C3C4C=CC(C4)C3C2=O)c1F |
| InChI | InChI=1S/C18H21FN4O2/c1-2-12-15(19)16(22-9-21-12)20-6-3-7-23-17(24)13-10-4-5-11(8-10)14(13)18(23)25/h4-5,9-11,13-14H,2-3,6-8H2,1H3,(H,20,21,22) |
| InChIKey | QAWYPCCJFRTQBF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|