About 4,5-dimethyl-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1,3-oxazole
4,5-dimethyl-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1,3-oxazole (PubChem CID 84593435) has the molecular formula C10H8F3N3OS
and a molecular weight of 275.25 g/mol. Its IUPAC name is 4,5-dimethyl-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1,3-oxazole.
Molecular Properties
| Compound Name | 4,5-dimethyl-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1,3-oxazole |
| PubChem CID | 84593435 |
| Molecular Formula | C10H8F3N3OS |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 4,5-dimethyl-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1,3-oxazole |
| SMILES | Cc1nc(Sc2ccc(C(F)(F)F)nn2)oc1C |
| InChI | InChI=1S/C10H8F3N3OS/c1-5-6(2)17-9(14-5)18-8-4-3-7(15-16-8)10(11,12)13/h3-4H,1-2H3 |
| InChIKey | DDNPBEUVJHEWJN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-dimethyl-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1,3-oxazole?
The IUPAC name of 4,5-dimethyl-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1,3-oxazole (CID 84593435) is 4,5-dimethyl-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1,3-oxazole.
What is the SMILES notation for 4,5-dimethyl-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1,3-oxazole?
The canonical SMILES for 4,5-dimethyl-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1,3-oxazole is Cc1nc(Sc2ccc(C(F)(F)F)nn2)oc1C.
What is the InChIKey of 4,5-dimethyl-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1,3-oxazole?
The InChIKey is DDNPBEUVJHEWJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3N3OS/c1-5-6(2)17-9(14-5)18-8-4-3-7(15-16-8)10(11,12)13/h3-4H,1-2H3.
What are the key properties of 4,5-dimethyl-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1,3-oxazole?
4,5-dimethyl-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1,3-oxazole has a molecular weight of 275.25 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2-[6-(trifluoromethyl)pyridazin-3-yl]sulfanyl-1,3-oxazole is sourced from PubChem (CID 84593435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).