C16H23F2NO3 — CID 84593559
[1-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-3-methylpiperidin-3-yl]methanol (PubChem CID 84593559) has the molecular formula C16H23F2NO3 and a molecular weight of 315.36 g/mol. Its IUPAC name is [1-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-3-methylpiperidin-3-yl]methanol.
| Compound Name | [1-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-3-methylpiperidin-3-yl]methanol |
|---|---|
| PubChem CID | 84593559 |
| Molecular Formula | C16H23F2NO3 |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | [1-[[2-(difluoromethoxy)-5-methoxyphenyl]methyl]-3-methylpiperidin-3-yl]methanol |
| SMILES | COc1ccc(OC(F)F)c(CN2CCCC(C)(CO)C2)c1 |
| InChI | InChI=1S/C16H23F2NO3/c1-16(11-20)6-3-7-19(10-16)9-12-8-13(21-2)4-5-14(12)22-15(17)18/h4-5,8,15,20H,3,6-7,9-11H2,1-2H3 |
| InChIKey | ACDOCDZLVKGBHZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |