About N-(1-hydroxy-4,4-dimethylpentan-2-yl)-1,2-oxazole-3-carboxamide
N-(1-hydroxy-4,4-dimethylpentan-2-yl)-1,2-oxazole-3-carboxamide (PubChem CID 84594032) has the molecular formula C11H18N2O3
and a molecular weight of 226.28 g/mol. Its IUPAC name is N-(1-hydroxy-4,4-dimethylpentan-2-yl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(1-hydroxy-4,4-dimethylpentan-2-yl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 84594032 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | N-(1-hydroxy-4,4-dimethylpentan-2-yl)-1,2-oxazole-3-carboxamide |
| SMILES | CC(C)(C)CC(CO)NC(=O)c1ccon1 |
| InChI | InChI=1S/C11H18N2O3/c1-11(2,3)6-8(7-14)12-10(15)9-4-5-16-13-9/h4-5,8,14H,6-7H2,1-3H3,(H,12,15) |
| InChIKey | BPYLOZFGKKTKAF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1-hydroxy-4,4-dimethylpentan-2-yl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-hydroxy-4,4-dimethylpentan-2-yl)-1,2-oxazole-3-carboxamide?
The IUPAC name of N-(1-hydroxy-4,4-dimethylpentan-2-yl)-1,2-oxazole-3-carboxamide (CID 84594032) is N-(1-hydroxy-4,4-dimethylpentan-2-yl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-(1-hydroxy-4,4-dimethylpentan-2-yl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-(1-hydroxy-4,4-dimethylpentan-2-yl)-1,2-oxazole-3-carboxamide is CC(C)(C)CC(CO)NC(=O)c1ccon1.
What is the InChIKey of N-(1-hydroxy-4,4-dimethylpentan-2-yl)-1,2-oxazole-3-carboxamide?
The InChIKey is BPYLOZFGKKTKAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3/c1-11(2,3)6-8(7-14)12-10(15)9-4-5-16-13-9/h4-5,8,14H,6-7H2,1-3H3,(H,12,15).
What are the key properties of N-(1-hydroxy-4,4-dimethylpentan-2-yl)-1,2-oxazole-3-carboxamide?
N-(1-hydroxy-4,4-dimethylpentan-2-yl)-1,2-oxazole-3-carboxamide has a molecular weight of 226.28 g/mol, XLogP of 1.20, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-hydroxy-4,4-dimethylpentan-2-yl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 84594032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).