About [phenyl(1,3-thiazol-2-yl)methyl] 1,5-dimethylpyrazole-4-carboxylate
[phenyl(1,3-thiazol-2-yl)methyl] 1,5-dimethylpyrazole-4-carboxylate (PubChem CID 84594086) has the molecular formula C16H15N3O2S
and a molecular weight of 313.38 g/mol. Its IUPAC name is [phenyl(1,3-thiazol-2-yl)methyl] 1,5-dimethylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | [phenyl(1,3-thiazol-2-yl)methyl] 1,5-dimethylpyrazole-4-carboxylate |
| PubChem CID | 84594086 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | [phenyl(1,3-thiazol-2-yl)methyl] 1,5-dimethylpyrazole-4-carboxylate |
| SMILES | Cc1c(C(=O)OC(c2ccccc2)c2nccs2)cnn1C |
| InChI | InChI=1S/C16H15N3O2S/c1-11-13(10-18-19(11)2)16(20)21-14(15-17-8-9-22-15)12-6-4-3-5-7-12/h3-10,14H,1-2H3 |
| InChIKey | TVNDTUQDKXEDBQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [phenyl(1,3-thiazol-2-yl)methyl] 1,5-dimethylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [phenyl(1,3-thiazol-2-yl)methyl] 1,5-dimethylpyrazole-4-carboxylate?
The IUPAC name of [phenyl(1,3-thiazol-2-yl)methyl] 1,5-dimethylpyrazole-4-carboxylate (CID 84594086) is [phenyl(1,3-thiazol-2-yl)methyl] 1,5-dimethylpyrazole-4-carboxylate.
What is the SMILES notation for [phenyl(1,3-thiazol-2-yl)methyl] 1,5-dimethylpyrazole-4-carboxylate?
The canonical SMILES for [phenyl(1,3-thiazol-2-yl)methyl] 1,5-dimethylpyrazole-4-carboxylate is Cc1c(C(=O)OC(c2ccccc2)c2nccs2)cnn1C.
What is the InChIKey of [phenyl(1,3-thiazol-2-yl)methyl] 1,5-dimethylpyrazole-4-carboxylate?
The InChIKey is TVNDTUQDKXEDBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O2S/c1-11-13(10-18-19(11)2)16(20)21-14(15-17-8-9-22-15)12-6-4-3-5-7-12/h3-10,14H,1-2H3.
What are the key properties of [phenyl(1,3-thiazol-2-yl)methyl] 1,5-dimethylpyrazole-4-carboxylate?
[phenyl(1,3-thiazol-2-yl)methyl] 1,5-dimethylpyrazole-4-carboxylate has a molecular weight of 313.38 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [phenyl(1,3-thiazol-2-yl)methyl] 1,5-dimethylpyrazole-4-carboxylate is sourced from PubChem (CID 84594086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).