About furan-3-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone
furan-3-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone (PubChem CID 84594381) has the molecular formula C12H14N4O2
and a molecular weight of 246.27 g/mol. Its IUPAC name is furan-3-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | furan-3-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone |
| PubChem CID | 84594381 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | furan-3-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccoc1)N1CCCCC1c1ncn[nH]1 |
| InChI | InChI=1S/C12H14N4O2/c17-12(9-4-6-18-7-9)16-5-2-1-3-10(16)11-13-8-14-15-11/h4,6-8,10H,1-3,5H2,(H,13,14,15) |
| InChIKey | QOKWIPQORQAKEH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze furan-3-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-3-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone?
The IUPAC name of furan-3-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone (CID 84594381) is furan-3-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone.
What is the SMILES notation for furan-3-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone?
The canonical SMILES for furan-3-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone is O=C(c1ccoc1)N1CCCCC1c1ncn[nH]1.
What is the InChIKey of furan-3-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone?
The InChIKey is QOKWIPQORQAKEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2/c17-12(9-4-6-18-7-9)16-5-2-1-3-10(16)11-13-8-14-15-11/h4,6-8,10H,1-3,5H2,(H,13,14,15).
What are the key properties of furan-3-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone?
furan-3-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone has a molecular weight of 246.27 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furan-3-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone is sourced from PubChem (CID 84594381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).