About 1-[(1-ethylpyrazol-4-yl)methyl]-2,2,4-trimethylpiperazine
1-[(1-ethylpyrazol-4-yl)methyl]-2,2,4-trimethylpiperazine (PubChem CID 84594416) has the molecular formula C13H24N4
and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-[(1-ethylpyrazol-4-yl)methyl]-2,2,4-trimethylpiperazine.
Molecular Properties
| Compound Name | 1-[(1-ethylpyrazol-4-yl)methyl]-2,2,4-trimethylpiperazine |
| PubChem CID | 84594416 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 1-[(1-ethylpyrazol-4-yl)methyl]-2,2,4-trimethylpiperazine |
| SMILES | CCn1cc(CN2CCN(C)CC2(C)C)cn1 |
| InChI | InChI=1S/C13H24N4/c1-5-17-10-12(8-14-17)9-16-7-6-15(4)11-13(16,2)3/h8,10H,5-7,9,11H2,1-4H3 |
| InChIKey | ONYMZORDQNSJNW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(1-ethylpyrazol-4-yl)methyl]-2,2,4-trimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1-ethylpyrazol-4-yl)methyl]-2,2,4-trimethylpiperazine?
The IUPAC name of 1-[(1-ethylpyrazol-4-yl)methyl]-2,2,4-trimethylpiperazine (CID 84594416) is 1-[(1-ethylpyrazol-4-yl)methyl]-2,2,4-trimethylpiperazine.
What is the SMILES notation for 1-[(1-ethylpyrazol-4-yl)methyl]-2,2,4-trimethylpiperazine?
The canonical SMILES for 1-[(1-ethylpyrazol-4-yl)methyl]-2,2,4-trimethylpiperazine is CCn1cc(CN2CCN(C)CC2(C)C)cn1.
What is the InChIKey of 1-[(1-ethylpyrazol-4-yl)methyl]-2,2,4-trimethylpiperazine?
The InChIKey is ONYMZORDQNSJNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4/c1-5-17-10-12(8-14-17)9-16-7-6-15(4)11-13(16,2)3/h8,10H,5-7,9,11H2,1-4H3.
What are the key properties of 1-[(1-ethylpyrazol-4-yl)methyl]-2,2,4-trimethylpiperazine?
1-[(1-ethylpyrazol-4-yl)methyl]-2,2,4-trimethylpiperazine has a molecular weight of 236.36 g/mol, XLogP of 1.43, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1-ethylpyrazol-4-yl)methyl]-2,2,4-trimethylpiperazine is sourced from PubChem (CID 84594416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).