C9H9IN4O3 — CID 84594788
5-iodo-1-methyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidine-2,4-dione (PubChem CID 84594788) has the molecular formula C9H9IN4O3 and a molecular weight of 348.10 g/mol. Its IUPAC name is 5-iodo-1-methyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidine-2,4-dione.
| Compound Name | 5-iodo-1-methyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 84594788 |
| Molecular Formula | C9H9IN4O3 |
| Molecular Weight | 348.10 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 5-iodo-1-methyl-3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pyrimidine-2,4-dione |
| SMILES | Cc1nc(Cn2c(=O)c(I)cn(C)c2=O)no1 |
| InChI | InChI=1S/C9H9IN4O3/c1-5-11-7(12-17-5)4-14-8(15)6(10)3-13(2)9(14)16/h3H,4H2,1-2H3 |
| InChIKey | DIDNNACWKUFFDF-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 82.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.10 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|