About [3-[(1,5-dimethylpyrazol-4-yl)methylamino]-4-pyridinyl]methanol
[3-[(1,5-dimethylpyrazol-4-yl)methylamino]-4-pyridinyl]methanol (PubChem CID 84595093) has the molecular formula C12H16N4O
and a molecular weight of 232.29 g/mol. Its IUPAC name is [3-[(1,5-dimethylpyrazol-4-yl)methylamino]-4-pyridinyl]methanol.
Molecular Properties
| Compound Name | [3-[(1,5-dimethylpyrazol-4-yl)methylamino]-4-pyridinyl]methanol |
| PubChem CID | 84595093 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | [3-[(1,5-dimethylpyrazol-4-yl)methylamino]-4-pyridinyl]methanol |
| SMILES | Cc1c(CNc2cnccc2CO)cnn1C |
| InChI | InChI=1S/C12H16N4O/c1-9-11(6-15-16(9)2)5-14-12-7-13-4-3-10(12)8-17/h3-4,6-7,14,17H,5,8H2,1-2H3 |
| InChIKey | CMXMTZKLCGOKQR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[(1,5-dimethylpyrazol-4-yl)methylamino]-4-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(1,5-dimethylpyrazol-4-yl)methylamino]-4-pyridinyl]methanol?
The IUPAC name of [3-[(1,5-dimethylpyrazol-4-yl)methylamino]-4-pyridinyl]methanol (CID 84595093) is [3-[(1,5-dimethylpyrazol-4-yl)methylamino]-4-pyridinyl]methanol.
What is the SMILES notation for [3-[(1,5-dimethylpyrazol-4-yl)methylamino]-4-pyridinyl]methanol?
The canonical SMILES for [3-[(1,5-dimethylpyrazol-4-yl)methylamino]-4-pyridinyl]methanol is Cc1c(CNc2cnccc2CO)cnn1C.
What is the InChIKey of [3-[(1,5-dimethylpyrazol-4-yl)methylamino]-4-pyridinyl]methanol?
The InChIKey is CMXMTZKLCGOKQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O/c1-9-11(6-15-16(9)2)5-14-12-7-13-4-3-10(12)8-17/h3-4,6-7,14,17H,5,8H2,1-2H3.
What are the key properties of [3-[(1,5-dimethylpyrazol-4-yl)methylamino]-4-pyridinyl]methanol?
[3-[(1,5-dimethylpyrazol-4-yl)methylamino]-4-pyridinyl]methanol has a molecular weight of 232.29 g/mol, XLogP of 1.23, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(1,5-dimethylpyrazol-4-yl)methylamino]-4-pyridinyl]methanol is sourced from PubChem (CID 84595093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).