C18H27FN2O2 — CID 84595277
1-[4-[[4-(4-fluorophenyl)-4-hydroxybutan-2-yl]amino]piperidin-1-yl]propan-1-one (PubChem CID 84595277) has the molecular formula C18H27FN2O2 and a molecular weight of 322.42 g/mol. Its IUPAC name is 1-[4-[[4-(4-fluorophenyl)-4-hydroxybutan-2-yl]amino]piperidin-1-yl]propan-1-one.
| Compound Name | 1-[4-[[4-(4-fluorophenyl)-4-hydroxybutan-2-yl]amino]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 84595277 |
| Molecular Formula | C18H27FN2O2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 1-[4-[[4-(4-fluorophenyl)-4-hydroxybutan-2-yl]amino]piperidin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCC(NC(C)CC(O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H27FN2O2/c1-3-18(23)21-10-8-16(9-11-21)20-13(2)12-17(22)14-4-6-15(19)7-5-14/h4-7,13,16-17,20,22H,3,8-12H2,1-2H3 |
| InChIKey | PPVDBLYFRJSEKL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |