C16H16N4O2 — CID 84595360
2-(furan-2-ylmethylamino)-N-(5-methyl-1H-imidazol-2-yl)benzamide (PubChem CID 84595360) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-(furan-2-ylmethylamino)-N-(5-methyl-1H-imidazol-2-yl)benzamide.
| Compound Name | 2-(furan-2-ylmethylamino)-N-(5-methyl-1H-imidazol-2-yl)benzamide |
|---|---|
| PubChem CID | 84595360 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 2-(furan-2-ylmethylamino)-N-(5-methyl-1H-imidazol-2-yl)benzamide |
| SMILES | Cc1cnc(NC(=O)c2ccccc2NCc2ccco2)[nH]1 |
| InChI | InChI=1S/C16H16N4O2/c1-11-9-18-16(19-11)20-15(21)13-6-2-3-7-14(13)17-10-12-5-4-8-22-12/h2-9,17H,10H2,1H3,(H2,18,19,20,21) |
| InChIKey | JAYHVGHSNBZCAX-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |