About cyclopentyl-[4-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]piperazin-1-yl]methanone
cyclopentyl-[4-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]piperazin-1-yl]methanone (PubChem CID 84595438) has the molecular formula C17H28N4OS
and a molecular weight of 336.50 g/mol. Its IUPAC name is cyclopentyl-[4-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | cyclopentyl-[4-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]piperazin-1-yl]methanone |
| PubChem CID | 84595438 |
| Molecular Formula | C17H28N4OS |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | cyclopentyl-[4-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]piperazin-1-yl]methanone |
| SMILES | CC(NCCN1CCN(C(=O)C2CCCC2)CC1)c1nccs1 |
| InChI | InChI=1S/C17H28N4OS/c1-14(16-19-7-13-23-16)18-6-8-20-9-11-21(12-10-20)17(22)15-4-2-3-5-15/h7,13-15,18H,2-6,8-12H2,1H3 |
| InChIKey | SALNQONBEZVSPE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclopentyl-[4-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl-[4-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]piperazin-1-yl]methanone?
The IUPAC name of cyclopentyl-[4-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]piperazin-1-yl]methanone (CID 84595438) is cyclopentyl-[4-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]piperazin-1-yl]methanone.
What is the SMILES notation for cyclopentyl-[4-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]piperazin-1-yl]methanone?
The canonical SMILES for cyclopentyl-[4-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]piperazin-1-yl]methanone is CC(NCCN1CCN(C(=O)C2CCCC2)CC1)c1nccs1.
What is the InChIKey of cyclopentyl-[4-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]piperazin-1-yl]methanone?
The InChIKey is SALNQONBEZVSPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N4OS/c1-14(16-19-7-13-23-16)18-6-8-20-9-11-21(12-10-20)17(22)15-4-2-3-5-15/h7,13-15,18H,2-6,8-12H2,1H3.
What are the key properties of cyclopentyl-[4-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]piperazin-1-yl]methanone?
cyclopentyl-[4-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]piperazin-1-yl]methanone has a molecular weight of 336.50 g/mol, XLogP of 2.13, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl-[4-[2-[1-(1,3-thiazol-2-yl)ethylamino]ethyl]piperazin-1-yl]methanone is sourced from PubChem (CID 84595438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).