About 5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-4H-1,4-benzoxazin-3-one
5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-4H-1,4-benzoxazin-3-one (PubChem CID 84595830) has the molecular formula C13H12N2O3S
and a molecular weight of 276.32 g/mol. Its IUPAC name is 5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-4H-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-4H-1,4-benzoxazin-3-one |
| PubChem CID | 84595830 |
| Molecular Formula | C13H12N2O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1ncc(COc2cccc3c2NC(=O)CO3)s1 |
| InChI | InChI=1S/C13H12N2O3S/c1-8-14-5-9(19-8)6-17-10-3-2-4-11-13(10)15-12(16)7-18-11/h2-5H,6-7H2,1H3,(H,15,16) |
| InChIKey | JKLFZRWJLBSMFU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-4H-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-4H-1,4-benzoxazin-3-one?
The IUPAC name of 5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-4H-1,4-benzoxazin-3-one (CID 84595830) is 5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-4H-1,4-benzoxazin-3-one.
What is the SMILES notation for 5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-4H-1,4-benzoxazin-3-one?
The canonical SMILES for 5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-4H-1,4-benzoxazin-3-one is Cc1ncc(COc2cccc3c2NC(=O)CO3)s1.
What is the InChIKey of 5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-4H-1,4-benzoxazin-3-one?
The InChIKey is JKLFZRWJLBSMFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O3S/c1-8-14-5-9(19-8)6-17-10-3-2-4-11-13(10)15-12(16)7-18-11/h2-5H,6-7H2,1H3,(H,15,16).
What are the key properties of 5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-4H-1,4-benzoxazin-3-one?
5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-4H-1,4-benzoxazin-3-one has a molecular weight of 276.32 g/mol, XLogP of 2.36, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-methyl-1,3-thiazol-5-yl)methoxy]-4H-1,4-benzoxazin-3-one is sourced from PubChem (CID 84595830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).