C17H24N6O — CID 84596923
N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-2-(propan-2-ylamino)pyridine-3-carboxamide (PubChem CID 84596923) has the molecular formula C17H24N6O and a molecular weight of 328.42 g/mol. Its IUPAC name is N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-2-(propan-2-ylamino)pyridine-3-carboxamide.
| Compound Name | N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-2-(propan-2-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 84596923 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | N-(2-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl)-2-(propan-2-ylamino)pyridine-3-carboxamide |
| SMILES | CCc1nc2n(n1)CCCC2NC(=O)c1cccnc1NC(C)C |
| InChI | InChI=1S/C17H24N6O/c1-4-14-21-16-13(8-6-10-23(16)22-14)20-17(24)12-7-5-9-18-15(12)19-11(2)3/h5,7,9,11,13H,4,6,8,10H2,1-3H3,(H,18,19)(H,20,24) |
| InChIKey | QQMVGKVEEVBAIS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |