About 1-methyl-3-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]pyrazin-2-one
1-methyl-3-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]pyrazin-2-one (PubChem CID 84597024) has the molecular formula C13H12F3N3O
and a molecular weight of 283.25 g/mol. Its IUPAC name is 1-methyl-3-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]pyrazin-2-one.
Molecular Properties
| Compound Name | 1-methyl-3-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]pyrazin-2-one |
| PubChem CID | 84597024 |
| Molecular Formula | C13H12F3N3O |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 1-methyl-3-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]pyrazin-2-one |
| SMILES | CN(Cc1cc(F)c(F)c(F)c1)c1nccn(C)c1=O |
| InChI | InChI=1S/C13H12F3N3O/c1-18-4-3-17-12(13(18)20)19(2)7-8-5-9(14)11(16)10(15)6-8/h3-6H,7H2,1-2H3 |
| InChIKey | USYSVOMLFCQGFZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]pyrazin-2-one?
The IUPAC name of 1-methyl-3-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]pyrazin-2-one (CID 84597024) is 1-methyl-3-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]pyrazin-2-one.
What is the SMILES notation for 1-methyl-3-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]pyrazin-2-one?
The canonical SMILES for 1-methyl-3-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]pyrazin-2-one is CN(Cc1cc(F)c(F)c(F)c1)c1nccn(C)c1=O.
What is the InChIKey of 1-methyl-3-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]pyrazin-2-one?
The InChIKey is USYSVOMLFCQGFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3N3O/c1-18-4-3-17-12(13(18)20)19(2)7-8-5-9(14)11(16)10(15)6-8/h3-6H,7H2,1-2H3.
What are the key properties of 1-methyl-3-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]pyrazin-2-one?
1-methyl-3-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]pyrazin-2-one has a molecular weight of 283.25 g/mol, XLogP of 1.83, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[methyl-[(3,4,5-trifluorophenyl)methyl]amino]pyrazin-2-one is sourced from PubChem (CID 84597024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).