C15H11ClFN3O3 — CID 84597542
(2-chloro-6-fluorophenyl)-(3-nitro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone (PubChem CID 84597542) has the molecular formula C15H11ClFN3O3 and a molecular weight of 335.72 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)-(3-nitro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone.
| Compound Name | (2-chloro-6-fluorophenyl)-(3-nitro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone |
|---|---|
| PubChem CID | 84597542 |
| Molecular Formula | C15H11ClFN3O3 |
| Molecular Weight | 335.72 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | (2-chloro-6-fluorophenyl)-(3-nitro-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone |
| SMILES | O=C(c1c(F)cccc1Cl)N1CCc2ncc([N+](=O)[O-])cc2C1 |
| InChI | InChI=1S/C15H11ClFN3O3/c16-11-2-1-3-12(17)14(11)15(21)19-5-4-13-9(8-19)6-10(7-18-13)20(22)23/h1-3,6-7H,4-5,8H2 |
| InChIKey | WUTMTHQIIPAPRS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.72 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|