About 3-[methyl-[(2-methyl-1,2,4-triazol-3-yl)methyl]amino]-1-phenylpropan-1-one
3-[methyl-[(2-methyl-1,2,4-triazol-3-yl)methyl]amino]-1-phenylpropan-1-one (PubChem CID 84597604) has the molecular formula C14H18N4O
and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-[methyl-[(2-methyl-1,2,4-triazol-3-yl)methyl]amino]-1-phenylpropan-1-one.
Molecular Properties
| Compound Name | 3-[methyl-[(2-methyl-1,2,4-triazol-3-yl)methyl]amino]-1-phenylpropan-1-one |
| PubChem CID | 84597604 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-[methyl-[(2-methyl-1,2,4-triazol-3-yl)methyl]amino]-1-phenylpropan-1-one |
| SMILES | CN(CCC(=O)c1ccccc1)Cc1ncnn1C |
| InChI | InChI=1S/C14H18N4O/c1-17(10-14-15-11-16-18(14)2)9-8-13(19)12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3 |
| InChIKey | JDMJFFGODYJNFC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[methyl-[(2-methyl-1,2,4-triazol-3-yl)methyl]amino]-1-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[methyl-[(2-methyl-1,2,4-triazol-3-yl)methyl]amino]-1-phenylpropan-1-one?
The IUPAC name of 3-[methyl-[(2-methyl-1,2,4-triazol-3-yl)methyl]amino]-1-phenylpropan-1-one (CID 84597604) is 3-[methyl-[(2-methyl-1,2,4-triazol-3-yl)methyl]amino]-1-phenylpropan-1-one.
What is the SMILES notation for 3-[methyl-[(2-methyl-1,2,4-triazol-3-yl)methyl]amino]-1-phenylpropan-1-one?
The canonical SMILES for 3-[methyl-[(2-methyl-1,2,4-triazol-3-yl)methyl]amino]-1-phenylpropan-1-one is CN(CCC(=O)c1ccccc1)Cc1ncnn1C.
What is the InChIKey of 3-[methyl-[(2-methyl-1,2,4-triazol-3-yl)methyl]amino]-1-phenylpropan-1-one?
The InChIKey is JDMJFFGODYJNFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O/c1-17(10-14-15-11-16-18(14)2)9-8-13(19)12-6-4-3-5-7-12/h3-7,11H,8-10H2,1-2H3.
What are the key properties of 3-[methyl-[(2-methyl-1,2,4-triazol-3-yl)methyl]amino]-1-phenylpropan-1-one?
3-[methyl-[(2-methyl-1,2,4-triazol-3-yl)methyl]amino]-1-phenylpropan-1-one has a molecular weight of 258.32 g/mol, XLogP of 1.52, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[methyl-[(2-methyl-1,2,4-triazol-3-yl)methyl]amino]-1-phenylpropan-1-one is sourced from PubChem (CID 84597604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).