C10H20N4O2S — CID 84598575
2-[(dimethylsulfamoylamino)methyl]-1-(2-methylpropyl)imidazole (PubChem CID 84598575) has the molecular formula C10H20N4O2S and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-[(dimethylsulfamoylamino)methyl]-1-(2-methylpropyl)imidazole.
| Compound Name | 2-[(dimethylsulfamoylamino)methyl]-1-(2-methylpropyl)imidazole |
|---|---|
| PubChem CID | 84598575 |
| Molecular Formula | C10H20N4O2S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-[(dimethylsulfamoylamino)methyl]-1-(2-methylpropyl)imidazole |
| SMILES | CC(C)Cn1ccnc1CNS(=O)(=O)N(C)C |
| InChI | InChI=1S/C10H20N4O2S/c1-9(2)8-14-6-5-11-10(14)7-12-17(15,16)13(3)4/h5-6,9,12H,7-8H2,1-4H3 |
| InChIKey | ZBXGMQUWAFJDOL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |