C12H12F3N3O2 — CID 84599390
2,4,5-trifluoro-N-[[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]aniline (PubChem CID 84599390) has the molecular formula C12H12F3N3O2 and a molecular weight of 287.24 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-[[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]aniline.
| Compound Name | 2,4,5-trifluoro-N-[[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]aniline |
|---|---|
| PubChem CID | 84599390 |
| Molecular Formula | C12H12F3N3O2 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2,4,5-trifluoro-N-[[3-(2-methoxyethyl)-1,2,4-oxadiazol-5-yl]methyl]aniline |
| SMILES | COCCc1noc(CNc2cc(F)c(F)cc2F)n1 |
| InChI | InChI=1S/C12H12F3N3O2/c1-19-3-2-11-17-12(20-18-11)6-16-10-5-8(14)7(13)4-9(10)15/h4-5,16H,2-3,6H2,1H3 |
| InChIKey | FYTKAILRDWDGDT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|