About 2-[1-(2-methylpropyl)imidazol-4-yl]sulfonyl-1,2-oxazolidine
2-[1-(2-methylpropyl)imidazol-4-yl]sulfonyl-1,2-oxazolidine (PubChem CID 84599896) has the molecular formula C10H17N3O3S
and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-[1-(2-methylpropyl)imidazol-4-yl]sulfonyl-1,2-oxazolidine.
Molecular Properties
| Compound Name | 2-[1-(2-methylpropyl)imidazol-4-yl]sulfonyl-1,2-oxazolidine |
| PubChem CID | 84599896 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-[1-(2-methylpropyl)imidazol-4-yl]sulfonyl-1,2-oxazolidine |
| SMILES | CC(C)Cn1cnc(S(=O)(=O)N2CCCO2)c1 |
| InChI | InChI=1S/C10H17N3O3S/c1-9(2)6-12-7-10(11-8-12)17(14,15)13-4-3-5-16-13/h7-9H,3-6H2,1-2H3 |
| InChIKey | YHJJZOIYLCWTJM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-(2-methylpropyl)imidazol-4-yl]sulfonyl-1,2-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2-methylpropyl)imidazol-4-yl]sulfonyl-1,2-oxazolidine?
The IUPAC name of 2-[1-(2-methylpropyl)imidazol-4-yl]sulfonyl-1,2-oxazolidine (CID 84599896) is 2-[1-(2-methylpropyl)imidazol-4-yl]sulfonyl-1,2-oxazolidine.
What is the SMILES notation for 2-[1-(2-methylpropyl)imidazol-4-yl]sulfonyl-1,2-oxazolidine?
The canonical SMILES for 2-[1-(2-methylpropyl)imidazol-4-yl]sulfonyl-1,2-oxazolidine is CC(C)Cn1cnc(S(=O)(=O)N2CCCO2)c1.
What is the InChIKey of 2-[1-(2-methylpropyl)imidazol-4-yl]sulfonyl-1,2-oxazolidine?
The InChIKey is YHJJZOIYLCWTJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O3S/c1-9(2)6-12-7-10(11-8-12)17(14,15)13-4-3-5-16-13/h7-9H,3-6H2,1-2H3.
What are the key properties of 2-[1-(2-methylpropyl)imidazol-4-yl]sulfonyl-1,2-oxazolidine?
2-[1-(2-methylpropyl)imidazol-4-yl]sulfonyl-1,2-oxazolidine has a molecular weight of 259.33 g/mol, XLogP of 0.87, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2-methylpropyl)imidazol-4-yl]sulfonyl-1,2-oxazolidine is sourced from PubChem (CID 84599896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).