About 1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 4-chloro-2-ethylsulfanylbenzoate
1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 4-chloro-2-ethylsulfanylbenzoate (PubChem CID 84600040) has the molecular formula C14H15ClN2O3S
and a molecular weight of 326.81 g/mol. Its IUPAC name is 1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 4-chloro-2-ethylsulfanylbenzoate.
Molecular Properties
| Compound Name | 1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 4-chloro-2-ethylsulfanylbenzoate |
| PubChem CID | 84600040 |
| Molecular Formula | C14H15ClN2O3S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 4-chloro-2-ethylsulfanylbenzoate |
| SMILES | CCSc1cc(Cl)ccc1C(=O)OC(C)c1nnc(C)o1 |
| InChI | InChI=1S/C14H15ClN2O3S/c1-4-21-12-7-10(15)5-6-11(12)14(18)19-8(2)13-17-16-9(3)20-13/h5-8H,4H2,1-3H3 |
| InChIKey | XBYYPSGMXBZKPX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 4-chloro-2-ethylsulfanylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 4-chloro-2-ethylsulfanylbenzoate?
The IUPAC name of 1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 4-chloro-2-ethylsulfanylbenzoate (CID 84600040) is 1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 4-chloro-2-ethylsulfanylbenzoate.
What is the SMILES notation for 1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 4-chloro-2-ethylsulfanylbenzoate?
The canonical SMILES for 1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 4-chloro-2-ethylsulfanylbenzoate is CCSc1cc(Cl)ccc1C(=O)OC(C)c1nnc(C)o1.
What is the InChIKey of 1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 4-chloro-2-ethylsulfanylbenzoate?
The InChIKey is XBYYPSGMXBZKPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN2O3S/c1-4-21-12-7-10(15)5-6-11(12)14(18)19-8(2)13-17-16-9(3)20-13/h5-8H,4H2,1-3H3.
What are the key properties of 1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 4-chloro-2-ethylsulfanylbenzoate?
1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 4-chloro-2-ethylsulfanylbenzoate has a molecular weight of 326.81 g/mol, XLogP of 4.06, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl 4-chloro-2-ethylsulfanylbenzoate is sourced from PubChem (CID 84600040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).