C9H9F4NO3S — CID 84600045
2-methoxy-N-(2,3,5,6-tetrafluorophenyl)ethanesulfonamide (PubChem CID 84600045) has the molecular formula C9H9F4NO3S and a molecular weight of 287.23 g/mol. Its IUPAC name is 2-methoxy-N-(2,3,5,6-tetrafluorophenyl)ethanesulfonamide.
| Compound Name | 2-methoxy-N-(2,3,5,6-tetrafluorophenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 84600045 |
| Molecular Formula | C9H9F4NO3S |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 2-methoxy-N-(2,3,5,6-tetrafluorophenyl)ethanesulfonamide |
| SMILES | COCCS(=O)(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C9H9F4NO3S/c1-17-2-3-18(15,16)14-9-7(12)5(10)4-6(11)8(9)13/h4,14H,2-3H2,1H3 |
| InChIKey | JCEOZQRZGQNJIZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|