About N-(1-cyclopentyl-2,2,2-trifluoroethyl)propane-1-sulfonamide
N-(1-cyclopentyl-2,2,2-trifluoroethyl)propane-1-sulfonamide (PubChem CID 84600262) has the molecular formula C10H18F3NO2S
and a molecular weight of 273.32 g/mol. Its IUPAC name is N-(1-cyclopentyl-2,2,2-trifluoroethyl)propane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(1-cyclopentyl-2,2,2-trifluoroethyl)propane-1-sulfonamide |
| PubChem CID | 84600262 |
| Molecular Formula | C10H18F3NO2S |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | N-(1-cyclopentyl-2,2,2-trifluoroethyl)propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NC(C1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C10H18F3NO2S/c1-2-7-17(15,16)14-9(10(11,12)13)8-5-3-4-6-8/h8-9,14H,2-7H2,1H3 |
| InChIKey | IQJCFZIPWPCPEM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1-cyclopentyl-2,2,2-trifluoroethyl)propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyclopentyl-2,2,2-trifluoroethyl)propane-1-sulfonamide?
The IUPAC name of N-(1-cyclopentyl-2,2,2-trifluoroethyl)propane-1-sulfonamide (CID 84600262) is N-(1-cyclopentyl-2,2,2-trifluoroethyl)propane-1-sulfonamide.
What is the SMILES notation for N-(1-cyclopentyl-2,2,2-trifluoroethyl)propane-1-sulfonamide?
The canonical SMILES for N-(1-cyclopentyl-2,2,2-trifluoroethyl)propane-1-sulfonamide is CCCS(=O)(=O)NC(C1CCCC1)C(F)(F)F.
What is the InChIKey of N-(1-cyclopentyl-2,2,2-trifluoroethyl)propane-1-sulfonamide?
The InChIKey is IQJCFZIPWPCPEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3NO2S/c1-2-7-17(15,16)14-9(10(11,12)13)8-5-3-4-6-8/h8-9,14H,2-7H2,1H3.
What are the key properties of N-(1-cyclopentyl-2,2,2-trifluoroethyl)propane-1-sulfonamide?
N-(1-cyclopentyl-2,2,2-trifluoroethyl)propane-1-sulfonamide has a molecular weight of 273.32 g/mol, XLogP of 2.44, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyclopentyl-2,2,2-trifluoroethyl)propane-1-sulfonamide is sourced from PubChem (CID 84600262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).